About N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine
N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine (PubChem CID 46044503) has the molecular formula C15H16Cl2N2
and a molecular weight of 295.21 g/mol. Its IUPAC name is N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine.
Molecular Properties
| Compound Name | N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine |
| PubChem CID | 46044503 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine |
| SMILES | CCN(C)Cc1cncc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H16Cl2N2/c1-3-19(2)10-11-6-13(9-18-8-11)12-4-5-14(16)15(17)7-12/h4-9H,3,10H2,1-2H3 |
| InChIKey | GOMRLSXJQWRCKW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine?
The IUPAC name of N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine (CID 46044503) is N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine.
What is the SMILES notation for N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine?
The canonical SMILES for N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine is CCN(C)Cc1cncc(-c2ccc(Cl)c(Cl)c2)c1.
What is the InChIKey of N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine?
The InChIKey is GOMRLSXJQWRCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2/c1-3-19(2)10-11-6-13(9-18-8-11)12-4-5-14(16)15(17)7-12/h4-9H,3,10H2,1-2H3.
What are the key properties of N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine?
N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine has a molecular weight of 295.21 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-N-methylethanamine is sourced from PubChem (CID 46044503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).