C18H14F3N3O4 — CID 4604520
4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[4-(trifluoromethoxy)phenyl]butanamide (PubChem CID 4604520) has the molecular formula C18H14F3N3O4 and a molecular weight of 393.32 g/mol. Its IUPAC name is 4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[4-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[4-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 4604520 |
| Molecular Formula | C18H14F3N3O4 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[4-(trifluoromethoxy)phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccnc2C1=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3N3O4/c19-18(20,21)28-12-7-5-11(6-8-12)23-14(25)4-2-10-24-16(26)13-3-1-9-22-15(13)17(24)27/h1,3,5-9H,2,4,10H2,(H,23,25) |
| InChIKey | BRTZXLOMQCEHNQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|