C27H23FN2O2 — CID 46045424
N-(3-fluorophenyl)-2-[4-[(3-phenoxyphenyl)methylamino]phenyl]acetamide (PubChem CID 46045424) has the molecular formula C27H23FN2O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[(3-phenoxyphenyl)methylamino]phenyl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[(3-phenoxyphenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 46045424 |
| Molecular Formula | C27H23FN2O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[(3-phenoxyphenyl)methylamino]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(NCc2cccc(Oc3ccccc3)c2)cc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C27H23FN2O2/c28-22-7-5-8-24(18-22)30-27(31)17-20-12-14-23(15-13-20)29-19-21-6-4-11-26(16-21)32-25-9-2-1-3-10-25/h1-16,18,29H,17,19H2,(H,30,31) |
| InChIKey | XSNALRIRBDOWPV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |