C27H30N2O2 — CID 46045963
N-[4-(2-anilino-2-oxoethyl)phenyl]-3-methyl-N-[(2-methylphenyl)methyl]butanamide (PubChem CID 46045963) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[4-(2-anilino-2-oxoethyl)phenyl]-3-methyl-N-[(2-methylphenyl)methyl]butanamide.
| Compound Name | N-[4-(2-anilino-2-oxoethyl)phenyl]-3-methyl-N-[(2-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 46045963 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[4-(2-anilino-2-oxoethyl)phenyl]-3-methyl-N-[(2-methylphenyl)methyl]butanamide |
| SMILES | Cc1ccccc1CN(C(=O)CC(C)C)c1ccc(CC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O2/c1-20(2)17-27(31)29(19-23-10-8-7-9-21(23)3)25-15-13-22(14-16-25)18-26(30)28-24-11-5-4-6-12-24/h4-16,20H,17-19H2,1-3H3,(H,28,30) |
| InChIKey | SUNDLWMLSJEVJA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |