C26H28N2O3 — CID 46045989
N-[4-[2-(4-methoxyanilino)-2-oxoethyl]phenyl]-N-[(3-methylphenyl)methyl]propanamide (PubChem CID 46045989) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[4-[2-(4-methoxyanilino)-2-oxoethyl]phenyl]-N-[(3-methylphenyl)methyl]propanamide.
| Compound Name | N-[4-[2-(4-methoxyanilino)-2-oxoethyl]phenyl]-N-[(3-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46045989 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[4-[2-(4-methoxyanilino)-2-oxoethyl]phenyl]-N-[(3-methylphenyl)methyl]propanamide |
| SMILES | CCC(=O)N(Cc1cccc(C)c1)c1ccc(CC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-4-26(30)28(18-21-7-5-6-19(2)16-21)23-12-8-20(9-13-23)17-25(29)27-22-10-14-24(31-3)15-11-22/h5-16H,4,17-18H2,1-3H3,(H,27,29) |
| InChIKey | QYGJYNHFJKMTJJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |