C39H38N6O8 — CID 4604690
4-[2-(6,7-dimethoxy-4-methyl-3-oxoquinoxalin-2-yl)ethyl]-10-(2-hydroxy-3-methylphenyl)-11-methyl-13-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4604690) has the molecular formula C39H38N6O8 and a molecular weight of 718.77 g/mol. Its IUPAC name is 4-[2-(6,7-dimethoxy-4-methyl-3-oxoquinoxalin-2-yl)ethyl]-10-(2-hydroxy-3-methylphenyl)-11-methyl-13-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 4-[2-(6,7-dimethoxy-4-methyl-3-oxoquinoxalin-2-yl)ethyl]-10-(2-hydroxy-3-methylphenyl)-11-methyl-13-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4604690 |
| Molecular Formula | C39H38N6O8 |
| Molecular Weight | 718.77 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | 4-[2-(6,7-dimethoxy-4-methyl-3-oxoquinoxalin-2-yl)ethyl]-10-(2-hydroxy-3-methylphenyl)-11-methyl-13-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cc2nc(CCn3c(=O)n4n(c3=O)C3CC5C(=O)N(c6ccccc6)C(=O)C5(C)C(c5cccc(C)c5O)C3=CC4)c(=O)n(C)c2cc1OC |
| InChI | InChI=1S/C39H38N6O8/c1-21-10-9-13-24(33(21)46)32-23-14-17-43-37(50)42(16-15-26-35(48)41(3)29-20-31(53-5)30(52-4)19-27(29)40-26)38(51)45(43)28(23)18-25-34(47)44(36(49)39(25,32)2)22-11-7-6-8-12-22/h6-14,19-20,25,28,32,46H,15-18H2,1-5H3 |
| InChIKey | ZAUZLEINAJVBDF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 159.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|