About 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione
7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione (PubChem CID 46046950) has the molecular formula C22H19FN4O2
and a molecular weight of 390.42 g/mol. Its IUPAC name is 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione |
| PubChem CID | 46046950 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione |
| SMILES | O=c1c2c(ncn2Cc2ccccc2)n(-c2cccc(F)c2)c(=O)n1CC1CC1 |
| InChI | InChI=1S/C22H19FN4O2/c23-17-7-4-8-18(11-17)27-20-19(21(28)26(22(27)29)13-16-9-10-16)25(14-24-20)12-15-5-2-1-3-6-15/h1-8,11,14,16H,9-10,12-13H2 |
| InChIKey | KPHYHEPGYCKPMV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione?
The IUPAC name of 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione (CID 46046950) is 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione.
What is the SMILES notation for 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione?
The canonical SMILES for 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione is O=c1c2c(ncn2Cc2ccccc2)n(-c2cccc(F)c2)c(=O)n1CC1CC1.
What is the InChIKey of 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione?
The InChIKey is KPHYHEPGYCKPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN4O2/c23-17-7-4-8-18(11-17)27-20-19(21(28)26(22(27)29)13-16-9-10-16)25(14-24-20)12-15-5-2-1-3-6-15/h1-8,11,14,16H,9-10,12-13H2.
What are the key properties of 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione?
7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione has a molecular weight of 390.42 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-1-(cyclopropylmethyl)-3-(3-fluorophenyl)purine-2,6-dione is sourced from PubChem (CID 46046950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).