C20H17ClN4O2 — CID 46046964
7-benzyl-3-(4-chlorophenyl)-1-ethylpurine-2,6-dione (PubChem CID 46046964) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is 7-benzyl-3-(4-chlorophenyl)-1-ethylpurine-2,6-dione.
| Compound Name | 7-benzyl-3-(4-chlorophenyl)-1-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 46046964 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 7-benzyl-3-(4-chlorophenyl)-1-ethylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccccc2)n(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C20H17ClN4O2/c1-2-24-19(26)17-18(22-13-23(17)12-14-6-4-3-5-7-14)25(20(24)27)16-10-8-15(21)9-11-16/h3-11,13H,2,12H2,1H3 |
| InChIKey | CTFJSYWATDKUNI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |