About 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione
3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 46047584) has the molecular formula C23H21F2N5O4
and a molecular weight of 469.45 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione.
Molecular Properties
| Compound Name | 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione |
| PubChem CID | 46047584 |
| Molecular Formula | C23H21F2N5O4 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | CC(C)CCn1c(=O)c2c(ncn2Cc2cccc([N+](=O)[O-])c2)n(-c2ccc(F)cc2F)c1=O |
| InChI | InChI=1S/C23H21F2N5O4/c1-14(2)8-9-28-22(31)20-21(29(23(28)32)19-7-6-16(24)11-18(19)25)26-13-27(20)12-15-4-3-5-17(10-15)30(33)34/h3-7,10-11,13-14H,8-9,12H2,1-2H3 |
| InChIKey | OCKKEECKBCLUNG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione?
The IUPAC name of 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione (CID 46047584) is 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione.
What is the SMILES notation for 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione?
The canonical SMILES for 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione is CC(C)CCn1c(=O)c2c(ncn2Cc2cccc([N+](=O)[O-])c2)n(-c2ccc(F)cc2F)c1=O.
What is the InChIKey of 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione?
The InChIKey is OCKKEECKBCLUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2N5O4/c1-14(2)8-9-28-22(31)20-21(29(23(28)32)19-7-6-16(24)11-18(19)25)26-13-27(20)12-15-4-3-5-17(10-15)30(33)34/h3-7,10-11,13-14H,8-9,12H2,1-2H3.
What are the key properties of 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione?
3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione has a molecular weight of 469.45 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluorophenyl)-1-(3-methylbutyl)-7-[(3-nitrophenyl)methyl]purine-2,6-dione is sourced from PubChem (CID 46047584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).