About ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate
ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate (PubChem CID 46047604) has the molecular formula C22H26N4O4
and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate |
| PubChem CID | 46047604 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate |
| SMILES | C=CCn1c(=O)c2c(ncn2C(C)C(=O)OCC)n(-c2ccc(C(C)C)cc2)c1=O |
| InChI | InChI=1S/C22H26N4O4/c1-6-12-24-20(27)18-19(23-13-25(18)15(5)21(28)30-7-2)26(22(24)29)17-10-8-16(9-11-17)14(3)4/h6,8-11,13-15H,1,7,12H2,2-5H3 |
| InChIKey | OSGKICJTJSWHIP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate?
The IUPAC name of ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate (CID 46047604) is ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate.
What is the SMILES notation for ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate?
The canonical SMILES for ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate is C=CCn1c(=O)c2c(ncn2C(C)C(=O)OCC)n(-c2ccc(C(C)C)cc2)c1=O.
What is the InChIKey of ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate?
The InChIKey is OSGKICJTJSWHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O4/c1-6-12-24-20(27)18-19(23-13-25(18)15(5)21(28)30-7-2)26(22(24)29)17-10-8-16(9-11-17)14(3)4/h6,8-11,13-15H,1,7,12H2,2-5H3.
What are the key properties of ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate?
ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate has a molecular weight of 410.47 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,6-dioxo-3-(4-propan-2-ylphenyl)-1-prop-2-enylpurin-7-yl]propanoate is sourced from PubChem (CID 46047604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).