About 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide
1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 46048534) has the molecular formula C17H21F2N3O3
and a molecular weight of 353.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide |
| PubChem CID | 46048534 |
| Molecular Formula | C17H21F2N3O3 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CCN(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C17H21F2N3O3/c18-12-1-2-15(14(19)11-12)22-5-3-13(17(22)24)16(23)20-4-6-21-7-9-25-10-8-21/h1-2,11,13H,3-10H2,(H,20,23) |
| InChIKey | CICYZQNSSKJBNM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide?
The IUPAC name of 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide (CID 46048534) is 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide?
The canonical SMILES for 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide is O=C(NCCN1CCOCC1)C1CCN(c2ccc(F)cc2F)C1=O.
What is the InChIKey of 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide?
The InChIKey is CICYZQNSSKJBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O3/c18-12-1-2-15(14(19)11-12)22-5-3-13(17(22)24)16(23)20-4-6-21-7-9-25-10-8-21/h1-2,11,13H,3-10H2,(H,20,23).
What are the key properties of 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide?
1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide has a molecular weight of 353.37 g/mol, XLogP of 0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 46048534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).