About 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine
2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine (PubChem CID 4604928) has the molecular formula C14H26N3+
and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine |
| PubChem CID | 4604928 |
| Molecular Formula | C14H26N3+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1=CC(=[N+]2CCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25N3/c1-14(2)10-12(15-16(3)4)9-13(11-14)17-7-5-6-8-17/h9H,5-8,10-11H2,1-4H3/p+1 |
| InChIKey | IUAJKIRSUDWOTD-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine (CID 4604928) is 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine is CN(C)NC1=CC(=[N+]2CCCC2)CC(C)(C)C1.
What is the InChIKey of 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
The InChIKey is IUAJKIRSUDWOTD-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H25N3/c1-14(2)10-12(15-16(3)4)9-13(11-14)17-7-5-6-8-17/h9H,5-8,10-11H2,1-4H3/p+1.
What are the key properties of 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine has a molecular weight of 236.38 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine is sourced from PubChem (CID 4604928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).