C25H25N5O5 — CID 46050332
[4-(4-methylphenoxy)-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-nitrophenyl)methanone (PubChem CID 46050332) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is [4-(4-methylphenoxy)-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(4-methylphenoxy)-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46050332 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [4-(4-methylphenoxy)-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1ccc(Oc2nc(N3CCOCC3)nc3c2CN(C(=O)c2ccc([N+](=O)[O-])cc2)CC3)cc1 |
| InChI | InChI=1S/C25H25N5O5/c1-17-2-8-20(9-3-17)35-23-21-16-29(24(31)18-4-6-19(7-5-18)30(32)33)11-10-22(21)26-25(27-23)28-12-14-34-15-13-28/h2-9H,10-16H2,1H3 |
| InChIKey | RXIQCKMXHHADOP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|