C21H24N4O4 — CID 46051560
N-(furan-2-ylmethyl)-2-[[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 46051560) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46051560 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1coc(CN2CCN(Cc3ccccc3O)CC2)n1 |
| InChI | InChI=1S/C21H24N4O4/c26-19-6-2-1-4-16(19)13-24-7-9-25(10-8-24)14-20-23-18(15-29-20)21(27)22-12-17-5-3-11-28-17/h1-6,11,15,26H,7-10,12-14H2,(H,22,27) |
| InChIKey | VCOZGKSTXXJIJY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|