C22H22FN5O4 — CID 46051627
N-(3-fluorophenyl)-2-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 46051627) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46051627 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(3-fluorophenyl)-2-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1coc(CN2CCN(Cc3ccccc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C22H22FN5O4/c23-17-5-3-6-18(12-17)24-22(29)19-15-32-21(25-19)14-27-10-8-26(9-11-27)13-16-4-1-2-7-20(16)28(30)31/h1-7,12,15H,8-11,13-14H2,(H,24,29) |
| InChIKey | OYOGZHCREPJLCX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|