C14H14N2OS — CID 4605327
4-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one (PubChem CID 4605327) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 4-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one.
| Compound Name | 4-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
|---|---|
| PubChem CID | 4605327 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)NC(=S)N2 |
| InChI | InChI=1S/C14H14N2OS/c17-11-8-4-7-10-12(11)13(16-14(18)15-10)9-5-2-1-3-6-9/h1-3,5-6,13H,4,7-8H2,(H2,15,16,18) |
| InChIKey | UFLOGXMJFGAFPU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|