C24H23F3N4O2 — CID 46053738
N-[6-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide (PubChem CID 46053738) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is N-[6-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[6-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46053738 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[6-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3O)CC2)nc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H23F3N4O2/c25-24(26,27)20-7-3-2-6-19(20)23(33)29-18-9-10-22(28-15-18)31-13-11-30(12-14-31)16-17-5-1-4-8-21(17)32/h1-10,15,32H,11-14,16H2,(H,29,33) |
| InChIKey | BFLINSZGQJNDHH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|