C29H32N2O2 — CID 46056563
N-benzyl-N-[3-[2-[benzyl(methyl)amino]-2-oxoethyl]phenyl]cyclopentanecarboxamide (PubChem CID 46056563) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-benzyl-N-[3-[2-[benzyl(methyl)amino]-2-oxoethyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-benzyl-N-[3-[2-[benzyl(methyl)amino]-2-oxoethyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 46056563 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-benzyl-N-[3-[2-[benzyl(methyl)amino]-2-oxoethyl]phenyl]cyclopentanecarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cc1cccc(N(Cc2ccccc2)C(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C29H32N2O2/c1-30(21-23-11-4-2-5-12-23)28(32)20-25-15-10-18-27(19-25)31(22-24-13-6-3-7-14-24)29(33)26-16-8-9-17-26/h2-7,10-15,18-19,26H,8-9,16-17,20-22H2,1H3 |
| InChIKey | OJITYWGIIPERBJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |