C25H29N3O2 — CID 4605846
N-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxybenzamide (PubChem CID 4605846) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4605846 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NN=Cc1cc(C)n(-c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C25H29N3O2/c1-17-15-19(16-26-27-24(29)22-9-7-8-10-23(22)30-6)18(2)28(17)21-13-11-20(12-14-21)25(3,4)5/h7-16H,1-6H3,(H,27,29) |
| InChIKey | ZNKZMBXJOPXVEJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|