C25H24F2N4O3 — CID 46061097
1-cyclohexyl-3-(3,4-difluorophenyl)-7-[(4-methoxyphenyl)methyl]purine-2,6-dione (PubChem CID 46061097) has the molecular formula C25H24F2N4O3 and a molecular weight of 466.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-difluorophenyl)-7-[(4-methoxyphenyl)methyl]purine-2,6-dione.
| Compound Name | 1-cyclohexyl-3-(3,4-difluorophenyl)-7-[(4-methoxyphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46061097 |
| Molecular Formula | C25H24F2N4O3 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-difluorophenyl)-7-[(4-methoxyphenyl)methyl]purine-2,6-dione |
| SMILES | COc1ccc(Cn2cnc3c2c(=O)n(C2CCCCC2)c(=O)n3-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C25H24F2N4O3/c1-34-19-10-7-16(8-11-19)14-29-15-28-23-22(29)24(32)31(17-5-3-2-4-6-17)25(33)30(23)18-9-12-20(26)21(27)13-18/h7-13,15,17H,2-6,14H2,1H3 |
| InChIKey | IRCRHIIKQWWNKV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |