C21H16ClFN4O2 — CID 46061729
7-[(2-chlorophenyl)methyl]-3-(3-fluorophenyl)-1-prop-2-enylpurine-2,6-dione (PubChem CID 46061729) has the molecular formula C21H16ClFN4O2 and a molecular weight of 410.84 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-3-(3-fluorophenyl)-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-3-(3-fluorophenyl)-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 46061729 |
| Molecular Formula | C21H16ClFN4O2 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-3-(3-fluorophenyl)-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2ccccc2Cl)n(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C21H16ClFN4O2/c1-2-10-26-20(28)18-19(27(21(26)29)16-8-5-7-15(23)11-16)24-13-25(18)12-14-6-3-4-9-17(14)22/h2-9,11,13H,1,10,12H2 |
| InChIKey | ACSCSAUQCONAHT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|