C28H25Cl2N5 — CID 4606190
2-amino-4-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonitrile (PubChem CID 4606190) has the molecular formula C28H25Cl2N5 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-amino-4-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4606190 |
| Molecular Formula | C28H25Cl2N5 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-amino-4-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1-c1cn(Cc3ccc(Cl)cc3Cl)nc1-c1ccccc1)CCCCCC2 |
| InChI | InChI=1S/C28H25Cl2N5/c29-20-13-12-19(24(30)14-20)16-35-17-23(27(34-35)18-8-4-3-5-9-18)26-21-10-6-1-2-7-11-25(21)33-28(32)22(26)15-31/h3-5,8-9,12-14,17H,1-2,6-7,10-11,16H2,(H2,32,33) |
| InChIKey | SILNUZXUQBRURB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |