C7H11N5O2 — CID 4606221
2-N,2-N,4-N-trimethyl-5-nitropyrimidine-2,4-diamine (PubChem CID 4606221) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-N,2-N,4-N-trimethyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-trimethyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 4606221 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-N,2-N,4-N-trimethyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CNc1nc(N(C)C)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N5O2/c1-8-6-5(12(13)14)4-9-7(10-6)11(2)3/h4H,1-3H3,(H,8,9,10) |
| InChIKey | MDINHBONPFDPJS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|