C20H19BrN2O4 — CID 46062571
N-(1,3-benzodioxol-5-ylmethyl)-1-(5-bromo-2-methylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 46062571) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-(5-bromo-2-methylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(5-bromo-2-methylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46062571 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(5-bromo-2-methylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(Br)cc1N1CCC(C(=O)NCc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C20H19BrN2O4/c1-12-2-4-14(21)9-16(12)23-7-6-15(20(23)25)19(24)22-10-13-3-5-17-18(8-13)27-11-26-17/h2-5,8-9,15H,6-7,10-11H2,1H3,(H,22,24) |
| InChIKey | SKDXNVVGAQPLFX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|