About 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid
2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 46065534) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 46065534 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)Oc1ccc(-c2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C13H13NO3S/c1-8(2)17-10-5-3-9(4-6-10)12-14-11(7-18-12)13(15)16/h3-8H,1-2H3,(H,15,16) |
| InChIKey | LLGQEFDWPCXNSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid (CID 46065534) is 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid is CC(C)Oc1ccc(-c2nc(C(=O)O)cs2)cc1.
What is the InChIKey of 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is LLGQEFDWPCXNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-8(2)17-10-5-3-9(4-6-10)12-14-11(7-18-12)13(15)16/h3-8H,1-2H3,(H,15,16).
What are the key properties of 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid?
2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 263.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propan-2-yloxyphenyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 46065534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).