C12H18F7NO — CID 4606680
2,2,3,3,4,4,4-heptafluoro-N,N-bis(2-methylpropyl)butanamide (PubChem CID 4606680) has the molecular formula C12H18F7NO and a molecular weight of 325.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N,N-bis(2-methylpropyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N,N-bis(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 4606680 |
| Molecular Formula | C12H18F7NO |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N,N-bis(2-methylpropyl)butanamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F7NO/c1-7(2)5-20(6-8(3)4)9(21)10(13,14)11(15,16)12(17,18)19/h7-8H,5-6H2,1-4H3 |
| InChIKey | NDFMNNOBKSRVCH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|