About 1-methyl-4,5-dihydroimidazol-2-amine
1-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 4606882) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is 1-methyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-methyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 4606882 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 1-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | CN1CCN=C1N |
| InChI | InChI=1S/C4H9N3/c1-7-3-2-6-4(7)5/h2-3H2,1H3,(H2,5,6) |
| InChIKey | LVZDYZBGDSGSCR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-methyl-4,5-dihydroimidazol-2-amine (CID 4606882) is 1-methyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-methyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-methyl-4,5-dihydroimidazol-2-amine is CN1CCN=C1N.
What is the InChIKey of 1-methyl-4,5-dihydroimidazol-2-amine?
The InChIKey is LVZDYZBGDSGSCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3/c1-7-3-2-6-4(7)5/h2-3H2,1H3,(H2,5,6).
What are the key properties of 1-methyl-4,5-dihydroimidazol-2-amine?
1-methyl-4,5-dihydroimidazol-2-amine has a molecular weight of 99.14 g/mol, XLogP of -0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 4606882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).