C28H32ClN3O — CID 46069186
2-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-6-methyl-N-(3-phenylpropyl)pyridine-3-carboxamide (PubChem CID 46069186) has the molecular formula C28H32ClN3O and a molecular weight of 462.04 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-6-methyl-N-(3-phenylpropyl)pyridine-3-carboxamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-6-methyl-N-(3-phenylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46069186 |
| Molecular Formula | C28H32ClN3O |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-6-methyl-N-(3-phenylpropyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCc2ccccc2)c(C2CCN(Cc3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C28H32ClN3O/c1-21-9-14-26(28(33)30-17-5-8-22-6-3-2-4-7-22)27(31-21)24-15-18-32(19-16-24)20-23-10-12-25(29)13-11-23/h2-4,6-7,9-14,24H,5,8,15-20H2,1H3,(H,30,33) |
| InChIKey | FFDZEFKIYFQHHP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|