C23H25F3N4O3 — CID 46070834
1-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-prop-2-enylurea (PubChem CID 46070834) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is 1-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-prop-2-enylurea.
| Compound Name | 1-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 46070834 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1cc(C)ccc1N1CCCN(Cc2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H25F3N4O3/c1-3-10-27-21(31)28-19-13-16(2)8-9-20(19)30-12-5-11-29(22(30)32)15-17-6-4-7-18(14-17)33-23(24,25)26/h3-4,6-9,13-14H,1,5,10-12,15H2,2H3,(H2,27,28,31) |
| InChIKey | BIQPPASGDAKWGW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|