C24H24O6 — CID 4607363
2,3,6,7,10,11-hexamethoxytriphenylene (PubChem CID 4607363) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexamethoxytriphenylene.
| Compound Name | 2,3,6,7,10,11-hexamethoxytriphenylene |
|---|---|
| PubChem CID | 4607363 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2,3,6,7,10,11-hexamethoxytriphenylene |
| SMILES | COc1cc2c3cc(OC)c(OC)cc3c3cc(OC)c(OC)cc3c2cc1OC |
| InChI | InChI=1S/C24H24O6/c1-25-19-7-13-14(8-20(19)26-2)16-10-22(28-4)24(30-6)12-18(16)17-11-23(29-5)21(27-3)9-15(13)17/h7-12H,1-6H3 |
| InChIKey | TXROZCSFVVIBFI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|