C22H21FN2O3S — CID 46074021
3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-methyl-N-propan-2-ylbenzamide (PubChem CID 46074021) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-methyl-N-propan-2-ylbenzamide.
| Compound Name | 3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 46074021 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-methyl-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C)C(=O)c1cccc(/C=C2\SC(=O)N(Cc3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C22H21FN2O3S/c1-14(2)24(3)20(26)17-6-4-5-16(11-17)12-19-21(27)25(22(28)29-19)13-15-7-9-18(23)10-8-15/h4-12,14H,13H2,1-3H3/b19-12- |
| InChIKey | GJUFIDFHETUNDE-UNOMPAQXSA-N |
| XLogP | 4.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|