C35H40N4O4 — CID 46075254
2-[1-ethyl-2,5-dioxo-4-(3-phenoxyphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-methyl-N-(3-phenylpropyl)pentanamide (PubChem CID 46075254) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 2-[1-ethyl-2,5-dioxo-4-(3-phenoxyphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-methyl-N-(3-phenylpropyl)pentanamide.
| Compound Name | 2-[1-ethyl-2,5-dioxo-4-(3-phenoxyphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-methyl-N-(3-phenylpropyl)pentanamide |
|---|---|
| PubChem CID | 46075254 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 2-[1-ethyl-2,5-dioxo-4-(3-phenoxyphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-methyl-N-(3-phenylpropyl)pentanamide |
| SMILES | CCN1C(=O)NC(c2cccc(Oc3ccccc3)c2)C2=C1CN(C(CC(C)C)C(=O)NCCCc1ccccc1)C2=O |
| InChI | InChI=1S/C35H40N4O4/c1-4-38-30-23-39(29(21-24(2)3)33(40)36-20-12-15-25-13-7-5-8-14-25)34(41)31(30)32(37-35(38)42)26-16-11-19-28(22-26)43-27-17-9-6-10-18-27/h5-11,13-14,16-19,22,24,29,32H,4,12,15,20-21,23H2,1-3H3,(H,36,40)(H,37,42) |
| InChIKey | DJTIOZSPKZFOAL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|