C26H28FN5O2 — CID 46076122
(3,5-dimethylphenyl)-[3-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 46076122) has the molecular formula C26H28FN5O2 and a molecular weight of 461.54 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-[3-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | (3,5-dimethylphenyl)-[3-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 46076122 |
| Molecular Formula | C26H28FN5O2 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (3,5-dimethylphenyl)-[3-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CCc3[nH]nc(C(=O)N4CCN(c5ccc(F)cc5)CC4)c3C2)c1 |
| InChI | InChI=1S/C26H28FN5O2/c1-17-13-18(2)15-19(14-17)25(33)32-8-7-23-22(16-32)24(29-28-23)26(34)31-11-9-30(10-12-31)21-5-3-20(27)4-6-21/h3-6,13-15H,7-12,16H2,1-2H3,(H,28,29) |
| InChIKey | WIKNAVUSUJYBGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |