C28H32N6O2 — CID 46076934
4-(6-benzyl-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-butyl-1,4-diazepane-1-carboxamide (PubChem CID 46076934) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-(6-benzyl-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-butyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(6-benzyl-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-butyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 46076934 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 4-(6-benzyl-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-butyl-1,4-diazepane-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCCN(c2nc(Cc3ccccc3)nc3onc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C28H32N6O2/c1-2-3-15-29-28(35)34-17-10-16-33(18-19-34)26-24-25(22-13-8-5-9-14-22)32-36-27(24)31-23(30-26)20-21-11-6-4-7-12-21/h4-9,11-14H,2-3,10,15-20H2,1H3,(H,29,35) |
| InChIKey | VRMVXHRNIZETIE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|