C23H34O5 — CID 4607778
[14-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-15-oxo-2,3,4,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 4607778) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [14-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-15-oxo-2,3,4,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [14-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-15-oxo-2,3,4,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 4607778 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [14-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-15-oxo-2,3,4,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)O)CC(=O)C32O)C1 |
| InChI | InChI=1S/C23H34O5/c1-13(24)19-12-20(26)23(27)18-6-5-15-11-16(28-14(2)25)7-9-21(15,3)17(18)8-10-22(19,23)4/h5,13,16-19,24,27H,6-12H2,1-4H3 |
| InChIKey | ASQBBZYQIJZHRU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|