About 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid
5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 4607782) has the molecular formula C13H14BrNO6
and a molecular weight of 360.16 g/mol. Its IUPAC name is 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| PubChem CID | 4607782 |
| Molecular Formula | C13H14BrNO6 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1C2CC(C1C(=O)O)C(N1C(=O)CCC1=O)C2Br |
| InChI | InChI=1S/C13H14BrNO6/c14-10-4-3-5(9(13(20)21)8(4)12(18)19)11(10)15-6(16)1-2-7(15)17/h4-5,8-11H,1-3H2,(H,18,19)(H,20,21) |
| InChIKey | DGUWCGCSFBDQTL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The IUPAC name of 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CID 4607782) is 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
What is the SMILES notation for 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The canonical SMILES for 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid is O=C(O)C1C2CC(C1C(=O)O)C(N1C(=O)CCC1=O)C2Br.
What is the InChIKey of 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The InChIKey is DGUWCGCSFBDQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO6/c14-10-4-3-5(9(13(20)21)8(4)12(18)19)11(10)15-6(16)1-2-7(15)17/h4-5,8-11H,1-3H2,(H,18,19)(H,20,21).
What are the key properties of 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid has a molecular weight of 360.16 g/mol, XLogP of 0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid is sourced from PubChem (CID 4607782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).