C21H30ClN5O — CID 46078862
2-chloro-N-[[3-methyl-5-(4-methylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl]-N-propylacetamide (PubChem CID 46078862) has the molecular formula C21H30ClN5O and a molecular weight of 403.96 g/mol. Its IUPAC name is 2-chloro-N-[[3-methyl-5-(4-methylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl]-N-propylacetamide.
| Compound Name | 2-chloro-N-[[3-methyl-5-(4-methylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 46078862 |
| Molecular Formula | C21H30ClN5O |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-chloro-N-[[3-methyl-5-(4-methylpiperazin-1-yl)-1-phenylpyrazol-4-yl]methyl]-N-propylacetamide |
| SMILES | CCCN(Cc1c(C)nn(-c2ccccc2)c1N1CCN(C)CC1)C(=O)CCl |
| InChI | InChI=1S/C21H30ClN5O/c1-4-10-26(20(28)15-22)16-19-17(2)23-27(18-8-6-5-7-9-18)21(19)25-13-11-24(3)12-14-25/h5-9H,4,10-16H2,1-3H3 |
| InChIKey | VHLRJLKJZQIYKS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|