C27H33FN6O4 — CID 46080400
N-[[1-(3-fluorophenyl)-3-methyl-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-N-(3-methoxypropyl)-3-nitrobenzamide (PubChem CID 46080400) has the molecular formula C27H33FN6O4 and a molecular weight of 524.60 g/mol. Its IUPAC name is N-[[1-(3-fluorophenyl)-3-methyl-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-N-(3-methoxypropyl)-3-nitrobenzamide.
| Compound Name | N-[[1-(3-fluorophenyl)-3-methyl-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-N-(3-methoxypropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 46080400 |
| Molecular Formula | C27H33FN6O4 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | N-[[1-(3-fluorophenyl)-3-methyl-5-(4-methylpiperazin-1-yl)pyrazol-4-yl]methyl]-N-(3-methoxypropyl)-3-nitrobenzamide |
| SMILES | COCCCN(Cc1c(C)nn(-c2cccc(F)c2)c1N1CCN(C)CC1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H33FN6O4/c1-20-25(19-32(11-6-16-38-3)27(35)21-7-4-10-24(17-21)34(36)37)26(31-14-12-30(2)13-15-31)33(29-20)23-9-5-8-22(28)18-23/h4-5,7-10,17-18H,6,11-16,19H2,1-3H3 |
| InChIKey | NDBVSZPMULYJBV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|