C25H39N5O — CID 46080531
N-butan-2-yl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]butanamide (PubChem CID 46080531) has the molecular formula C25H39N5O and a molecular weight of 425.62 g/mol. Its IUPAC name is N-butan-2-yl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]butanamide.
| Compound Name | N-butan-2-yl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 46080531 |
| Molecular Formula | C25H39N5O |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.32 |
| IUPAC Name | N-butan-2-yl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]butanamide |
| SMILES | CCCC(=O)N(Cc1c(C)nn(-c2ccccc2)c1N1CCN(CC)CC1)C(C)CC |
| InChI | InChI=1S/C25H39N5O/c1-6-12-24(31)29(20(4)7-2)19-23-21(5)26-30(22-13-10-9-11-14-22)25(23)28-17-15-27(8-3)16-18-28/h9-11,13-14,20H,6-8,12,15-19H2,1-5H3 |
| InChIKey | ZQJZKYCDMZQAPN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |