C29H37FN6O3 — CID 46080660
N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-3-nitro-N-propylbenzamide (PubChem CID 46080660) has the molecular formula C29H37FN6O3 and a molecular weight of 536.65 g/mol. Its IUPAC name is N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-3-nitro-N-propylbenzamide.
| Compound Name | N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 46080660 |
| Molecular Formula | C29H37FN6O3 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | N-[[3-ethyl-1-(4-fluorophenyl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazol-4-yl]methyl]-3-nitro-N-propylbenzamide |
| SMILES | CCCN(Cc1c(CC)nn(-c2ccc(F)cc2)c1N1CCN(C(C)C)CC1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H37FN6O3/c1-5-14-34(29(37)22-8-7-9-25(19-22)36(38)39)20-26-27(6-2)31-35(24-12-10-23(30)11-13-24)28(26)33-17-15-32(16-18-33)21(3)4/h7-13,19,21H,5-6,14-18,20H2,1-4H3 |
| InChIKey | GREBMHMSQDFQRR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|