C20H23F2N3O2 — CID 46081034
[6-(2,5-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-(2,6-dimethylmorpholin-4-yl)methanone (PubChem CID 46081034) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is [6-(2,5-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-(2,6-dimethylmorpholin-4-yl)methanone.
| Compound Name | [6-(2,5-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 46081034 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [6-(2,5-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cn3c(n2)CCC(c2cc(F)ccc2F)C3)CC(C)O1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-12-8-25(9-13(2)27-12)20(26)18-11-24-10-14(3-6-19(24)23-18)16-7-15(21)4-5-17(16)22/h4-5,7,11-14H,3,6,8-10H2,1-2H3 |
| InChIKey | GUUBMXDEFCBELU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |