About 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one
3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one (PubChem CID 46081488) has the molecular formula C15H16Cl2N2O3
and a molecular weight of 343.21 g/mol. Its IUPAC name is 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 46081488 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc2oc(=O)n(C3CCN(C(=O)C(Cl)Cl)CC3)c2c1 |
| InChI | InChI=1S/C15H16Cl2N2O3/c1-9-2-3-12-11(8-9)19(15(21)22-12)10-4-6-18(7-5-10)14(20)13(16)17/h2-3,8,10,13H,4-7H2,1H3 |
| InChIKey | KYSFPUVSMGSDSJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one (CID 46081488) is 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one is Cc1ccc2oc(=O)n(C3CCN(C(=O)C(Cl)Cl)CC3)c2c1.
What is the InChIKey of 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one?
The InChIKey is KYSFPUVSMGSDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2O3/c1-9-2-3-12-11(8-9)19(15(21)22-12)10-4-6-18(7-5-10)14(20)13(16)17/h2-3,8,10,13H,4-7H2,1H3.
What are the key properties of 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one?
3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one has a molecular weight of 343.21 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,2-dichloroacetyl)piperidin-4-yl]-5-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 46081488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).