C20H24N4O4 — CID 46081694
methyl 3-[4-[4-(4-ethoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropanoate (PubChem CID 46081694) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl 3-[4-[4-(4-ethoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[4-(4-ethoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 46081694 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl 3-[4-[4-(4-ethoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropanoate |
| SMILES | CCOc1ccc(-c2ccnc(N3CCN(C(=O)CC(=O)OC)CC3)n2)cc1 |
| InChI | InChI=1S/C20H24N4O4/c1-3-28-16-6-4-15(5-7-16)17-8-9-21-20(22-17)24-12-10-23(11-13-24)18(25)14-19(26)27-2/h4-9H,3,10-14H2,1-2H3 |
| InChIKey | WFKYZQDTMSNHAJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|