C30H37N3O3 — CID 46081816
ethyl 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-pentan-3-ylpyrazole-3-carboxylate (PubChem CID 46081816) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is ethyl 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-pentan-3-ylpyrazole-3-carboxylate.
| Compound Name | ethyl 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-pentan-3-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46081816 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | ethyl 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-pentan-3-ylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(CC)CC)n(-c2ccc(C(=O)N3CCC(Cc4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C30H37N3O3/c1-4-24(5-2)28-21-27(30(35)36-6-3)31-33(28)26-14-12-25(13-15-26)29(34)32-18-16-23(17-19-32)20-22-10-8-7-9-11-22/h7-15,21,23-24H,4-6,16-20H2,1-3H3 |
| InChIKey | LSLWITFDXGJNAD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |