C22H22F7N5O2 — CID 46082070
2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(4-morpholin-4-ylphenyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-one (PubChem CID 46082070) has the molecular formula C22H22F7N5O2 and a molecular weight of 521.44 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(4-morpholin-4-ylphenyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(4-morpholin-4-ylphenyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 46082070 |
| Molecular Formula | C22H22F7N5O2 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(4-morpholin-4-ylphenyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(N1CCN(c2nccc(-c3ccc(N4CCOCC4)cc3)n2)CC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H22F7N5O2/c23-20(24,21(25,26)22(27,28)29)18(35)33-7-9-34(10-8-33)19-30-6-5-17(31-19)15-1-3-16(4-2-15)32-11-13-36-14-12-32/h1-6H,7-14H2 |
| InChIKey | TZTZDQZFDQSYLD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|