C19H15F7N4O3 — CID 46082101
1-[4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 46082101) has the molecular formula C19H15F7N4O3 and a molecular weight of 480.34 g/mol. Its IUPAC name is 1-[4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-[4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 46082101 |
| Molecular Formula | C19H15F7N4O3 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 1-[4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | O=C(N1CCN(c2nccc(-c3ccc4c(c3)OCO4)n2)CC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15F7N4O3/c20-17(21,18(22,23)19(24,25)26)15(31)29-5-7-30(8-6-29)16-27-4-3-12(28-16)11-1-2-13-14(9-11)33-10-32-13/h1-4,9H,5-8,10H2 |
| InChIKey | OGMRTYLXJVZBIR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|