C22H19F5N4O3S — CID 46082164
4-(4-ethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 46082164) has the molecular formula C22H19F5N4O3S and a molecular weight of 514.48 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(4-ethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 46082164 |
| Molecular Formula | C22H19F5N4O3S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 4-(4-ethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | CCOc1ccc(-c2ccnc(N3CCN(S(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)CC3)n2)cc1 |
| InChI | InChI=1S/C22H19F5N4O3S/c1-2-34-14-5-3-13(4-6-14)15-7-8-28-22(29-15)30-9-11-31(12-10-30)35(32,33)21-19(26)17(24)16(23)18(25)20(21)27/h3-8H,2,9-12H2,1H3 |
| InChIKey | LOVYXNYFTKGQMP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|