About 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide
4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide (PubChem CID 46082466) has the molecular formula C22H18FNO3
and a molecular weight of 363.39 g/mol. Its IUPAC name is 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide |
| PubChem CID | 46082466 |
| Molecular Formula | C22H18FNO3 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide |
| SMILES | O=C(NCC1Cc2cc(Oc3ccccc3)ccc2O1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FNO3/c23-17-8-6-15(7-9-17)22(25)24-14-20-13-16-12-19(10-11-21(16)27-20)26-18-4-2-1-3-5-18/h1-12,20H,13-14H2,(H,24,25) |
| InChIKey | BFYZZVIZHVSYJM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide?
The IUPAC name of 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide (CID 46082466) is 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide.
What is the SMILES notation for 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide?
The canonical SMILES for 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide is O=C(NCC1Cc2cc(Oc3ccccc3)ccc2O1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide?
The InChIKey is BFYZZVIZHVSYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18FNO3/c23-17-8-6-15(7-9-17)22(25)24-14-20-13-16-12-19(10-11-21(16)27-20)26-18-4-2-1-3-5-18/h1-12,20H,13-14H2,(H,24,25).
What are the key properties of 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide?
4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide has a molecular weight of 363.39 g/mol, XLogP of 4.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]benzamide is sourced from PubChem (CID 46082466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).