C24H26ClN3O3 — CID 46083143
ethyl 5-(4-chlorophenyl)-1-[4-(3-methylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate (PubChem CID 46083143) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-1-[4-(3-methylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-1-[4-(3-methylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46083143 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-1-[4-(3-methylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccc(C(=O)NCCC(C)C)cc2)n1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-4-31-24(30)21-15-22(17-5-9-19(25)10-6-17)28(27-21)20-11-7-18(8-12-20)23(29)26-14-13-16(2)3/h5-12,15-16H,4,13-14H2,1-3H3,(H,26,29) |
| InChIKey | BXNBUIWYBOUEQL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |