About cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol
cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (PubChem CID 4608370) has the molecular formula C16H16CoN2O2
and a molecular weight of 327.25 g/mol. Its IUPAC name is cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol.
Molecular Properties
| Compound Name | cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| PubChem CID | 4608370 |
| Molecular Formula | C16H16CoN2O2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[Co] |
| InChI | InChI=1S/C16H16N2O2.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/b17-11+,18-12+; |
| InChIKey | VZHHNBNSMNNUAD-OYJDLGDISA-N |
| XLogP | 2.63 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol?
The IUPAC name of cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (CID 4608370) is cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol.
What is the SMILES notation for cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol?
The canonical SMILES for cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol is Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[Co].
What is the InChIKey of cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol?
The InChIKey is VZHHNBNSMNNUAD-OYJDLGDISA-N. The full InChI is InChI=1S/C16H16N2O2.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/b17-11+,18-12+;.
What are the key properties of cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol?
cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol has a molecular weight of 327.25 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol is sourced from PubChem (CID 4608370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).